About 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine
2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine (PubChem CID 164530270) has the molecular formula C16H20F2N4OS
and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine |
| PubChem CID | 164530270 |
| Molecular Formula | C16H20F2N4OS |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine |
| SMILES | NCC(c1scnc1C(F)F)N1CCC(Oc2ccccn2)CC1 |
| InChI | InChI=1S/C16H20F2N4OS/c17-16(18)14-15(24-10-21-14)12(9-19)22-7-4-11(5-8-22)23-13-3-1-2-6-20-13/h1-3,6,10-12,16H,4-5,7-9,19H2 |
| InChIKey | YRZJBZRAKHVCAN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine?
The IUPAC name of 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine (CID 164530270) is 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine.
What is the SMILES notation for 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine?
The canonical SMILES for 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine is NCC(c1scnc1C(F)F)N1CCC(Oc2ccccn2)CC1.
What is the InChIKey of 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine?
The InChIKey is YRZJBZRAKHVCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20F2N4OS/c17-16(18)14-15(24-10-21-14)12(9-19)22-7-4-11(5-8-22)23-13-3-1-2-6-20-13/h1-3,6,10-12,16H,4-5,7-9,19H2.
What are the key properties of 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine?
2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine has a molecular weight of 354.43 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethyl)-1,3-thiazol-5-yl]-2-(4-pyridin-2-yloxypiperidin-1-yl)ethanamine is sourced from PubChem (CID 164530270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).