C18H26OS2 — CID 164530817
ethane;4-ethyl-8,8-dimethyl-11-propan-2-yl-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene (PubChem CID 164530817) has the molecular formula C18H26OS2 and a molecular weight of 322.54 g/mol. Its IUPAC name is ethane;4-ethyl-8,8-dimethyl-11-propan-2-yl-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene.
| Compound Name | ethane;4-ethyl-8,8-dimethyl-11-propan-2-yl-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene |
|---|---|
| PubChem CID | 164530817 |
| Molecular Formula | C18H26OS2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethane;4-ethyl-8,8-dimethyl-11-propan-2-yl-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraene |
| SMILES | CC.CCc1cc2c(s1)-c1sc(C(C)C)cc1C(C)(C)O2 |
| InChI | InChI=1S/C16H20OS2.C2H6/c1-6-10-7-12-15(18-10)14-11(16(4,5)17-12)8-13(19-14)9(2)3;1-2/h7-9H,6H2,1-5H3;1-2H3 |
| InChIKey | NMDFAGILCGKTPV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |