C14H24N6O — CID 164531086
(8R)-4-[(3R)-3-aminopyrrolidin-1-yl]-8-propan-2-yl-6,7,8,9-tetrahydropyrimido[5,4-b][1,4]oxazepin-2-amine (PubChem CID 164531086) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is (8R)-4-[(3R)-3-aminopyrrolidin-1-yl]-8-propan-2-yl-6,7,8,9-tetrahydropyrimido[5,4-b][1,4]oxazepin-2-amine.
| Compound Name | (8R)-4-[(3R)-3-aminopyrrolidin-1-yl]-8-propan-2-yl-6,7,8,9-tetrahydropyrimido[5,4-b][1,4]oxazepin-2-amine |
|---|---|
| PubChem CID | 164531086 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (8R)-4-[(3R)-3-aminopyrrolidin-1-yl]-8-propan-2-yl-6,7,8,9-tetrahydropyrimido[5,4-b][1,4]oxazepin-2-amine |
| SMILES | CC(C)[C@H]1CCOc2c(nc(N)nc2N2CC[C@@H](N)C2)N1 |
| InChI | InChI=1S/C14H24N6O/c1-8(2)10-4-6-21-11-12(17-10)18-14(16)19-13(11)20-5-3-9(15)7-20/h8-10H,3-7,15H2,1-2H3,(H3,16,17,18,19)/t9-,10-/m1/s1 |
| InChIKey | XUWNAIJUCGKWGP-NXEZZACHSA-N |
| XLogP | 0.82 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |