C17H21F3O5S — CID 164531210
[3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfonate;prop-1-ene (PubChem CID 164531210) has the molecular formula C17H21F3O5S and a molecular weight of 394.41 g/mol. Its IUPAC name is [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfonate;prop-1-ene.
| Compound Name | [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfonate;prop-1-ene |
|---|---|
| PubChem CID | 164531210 |
| Molecular Formula | C17H21F3O5S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [3,5-dihydroxy-4-(3-methylcyclohex-2-en-1-yl)phenyl] trifluoromethanesulfonate;prop-1-ene |
| SMILES | C=CC.CC1=CC(c2c(O)cc(OS(=O)(=O)C(F)(F)F)cc2O)CCC1 |
| InChI | InChI=1S/C14H15F3O5S.C3H6/c1-8-3-2-4-9(5-8)13-11(18)6-10(7-12(13)19)22-23(20,21)14(15,16)17;1-3-2/h5-7,9,18-19H,2-4H2,1H3;3H,1H2,2H3 |
| InChIKey | LGWRFDCZWGURQD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|