C8H9F3O — CID 164531286
(3aS,4R,6aS)-4,5,5-trifluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one (PubChem CID 164531286) has the molecular formula C8H9F3O and a molecular weight of 178.15 g/mol. Its IUPAC name is (3aS,4R,6aS)-4,5,5-trifluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aS,4R,6aS)-4,5,5-trifluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 164531286 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3aS,4R,6aS)-4,5,5-trifluoro-1,3,3a,4,6,6a-hexahydropentalen-2-one |
| SMILES | O=C1C[C@H]2CC(F)(F)[C@H](F)[C@H]2C1 |
| InChI | InChI=1S/C8H9F3O/c9-7-6-2-5(12)1-4(6)3-8(7,10)11/h4,6-7H,1-3H2/t4-,6-,7+/m0/s1 |
| InChIKey | ZUEIJDVIMFEJJT-JSKYLQRQSA-N |
| XLogP | 1.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |