C10H13FO3 — CID 164531305
(1R)-1-fluorospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one (PubChem CID 164531305) has the molecular formula C10H13FO3 and a molecular weight of 200.21 g/mol. Its IUPAC name is (1R)-1-fluorospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one.
| Compound Name | (1R)-1-fluorospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one |
|---|---|
| PubChem CID | 164531305 |
| Molecular Formula | C10H13FO3 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (1R)-1-fluorospiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxolane]-2-one |
| SMILES | O=C1CC2CC3(CC2[C@H]1F)OCCO3 |
| InChI | InChI=1S/C10H13FO3/c11-9-7-5-10(13-1-2-14-10)4-6(7)3-8(9)12/h6-7,9H,1-5H2/t6?,7?,9-/m1/s1 |
| InChIKey | VGYNSLWEXUPUIY-QXUHLLMWSA-N |
| XLogP | 1.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |