C24H22FNO2 — CID 164531756
2-(4-fluorophenyl)-N-[4-[4-(methoxymethyl)phenyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 164531756) has the molecular formula C24H22FNO2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[4-(methoxymethyl)phenyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[4-(methoxymethyl)phenyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 164531756 |
| Molecular Formula | C24H22FNO2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[4-(methoxymethyl)phenyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | COCc1ccc(-c2ccc(NC(=O)C3CC3c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22FNO2/c1-28-15-16-2-4-17(5-3-16)18-8-12-21(13-9-18)26-24(27)23-14-22(23)19-6-10-20(25)11-7-19/h2-13,22-23H,14-15H2,1H3,(H,26,27) |
| InChIKey | OBOQOCSWHGMCEV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |