C25H26FNO3 — CID 164531778
2-(4-fluorophenoxy)-N-[4-[4-(1-methoxyethyl)phenyl]phenyl]-2-methylpropanamide (PubChem CID 164531778) has the molecular formula C25H26FNO3 and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[4-[4-(1-methoxyethyl)phenyl]phenyl]-2-methylpropanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[4-[4-(1-methoxyethyl)phenyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 164531778 |
| Molecular Formula | C25H26FNO3 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[4-[4-(1-methoxyethyl)phenyl]phenyl]-2-methylpropanamide |
| SMILES | COC(C)c1ccc(-c2ccc(NC(=O)C(C)(C)Oc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H26FNO3/c1-17(29-4)18-5-7-19(8-6-18)20-9-13-22(14-10-20)27-24(28)25(2,3)30-23-15-11-21(26)12-16-23/h5-17H,1-4H3,(H,27,28) |
| InChIKey | BKOIHTSRLQOMRR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |