C23H26ClFN4O5 — CID 164532020
3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 164532020) has the molecular formula C23H26ClFN4O5 and a molecular weight of 492.94 g/mol. Its IUPAC name is 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 164532020 |
| Molecular Formula | C23H26ClFN4O5 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | NC(=O)C(=O)C(C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CC1)NC(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H26ClFN4O5/c24-15-5-3-13(16(25)11-15)4-6-19(30)28-18(9-12-1-2-12)23(34)29-17(20(31)21(26)32)10-14-7-8-27-22(14)33/h3-6,11-12,14,17-18H,1-2,7-10H2,(H2,26,32)(H,27,33)(H,28,30)(H,29,34)/b6-4+/t14-,17?,18-/m0/s1 |
| InChIKey | MWADHAZFTKJTCU-VFYFTYRSSA-N |
| XLogP | 0.84 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|