C24H4BF15 — CID 164532168
[2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-bis(2,3,6-trifluorophenyl)borane (PubChem CID 164532168) has the molecular formula C24H4BF15 and a molecular weight of 588.08 g/mol. Its IUPAC name is [2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-bis(2,3,6-trifluorophenyl)borane.
| Compound Name | [2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-bis(2,3,6-trifluorophenyl)borane |
|---|---|
| PubChem CID | 164532168 |
| Molecular Formula | C24H4BF15 |
| Molecular Weight | 588.08 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | [2,3,4,5-tetrafluoro-6-(2,3,4,5,6-pentafluorophenyl)phenyl]-bis(2,3,6-trifluorophenyl)borane |
| SMILES | Fc1ccc(F)c(B(c2c(F)ccc(F)c2F)c2c(F)c(F)c(F)c(F)c2-c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C24H4BF15/c26-5-1-3-7(28)14(30)11(5)25(12-6(27)2-4-8(29)15(12)31)13-9(16(32)20(36)23(39)19(13)35)10-17(33)21(37)24(40)22(38)18(10)34/h1-4H |
| InChIKey | LQTQSFPLWMWWOZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|