C22H30N6O — CID 164532314
N-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-imidazo[4,5-b]pyridin-6-yl]-N,4-dimethylpentanamide (PubChem CID 164532314) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-imidazo[4,5-b]pyridin-6-yl]-N,4-dimethylpentanamide.
| Compound Name | N-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-imidazo[4,5-b]pyridin-6-yl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 164532314 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | N-[2-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-imidazo[4,5-b]pyridin-6-yl]-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)c1cnc2nc(-c3n[nH]c4c3CCC(C)(C)C4)[nH]c2c1 |
| InChI | InChI=1S/C22H30N6O/c1-13(2)6-7-18(29)28(5)14-10-16-20(23-12-14)25-21(24-16)19-15-8-9-22(3,4)11-17(15)26-27-19/h10,12-13H,6-9,11H2,1-5H3,(H,26,27)(H,23,24,25) |
| InChIKey | CSEDRBONKQMHJQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |