C22H32N6OSi — CID 164532385
2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-N-methyl-1H-imidazo[4,5-b]pyridin-6-amine (PubChem CID 164532385) has the molecular formula C22H32N6OSi and a molecular weight of 424.63 g/mol. Its IUPAC name is 2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-N-methyl-1H-imidazo[4,5-b]pyridin-6-amine.
| Compound Name | 2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-N-methyl-1H-imidazo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 164532385 |
| Molecular Formula | C22H32N6OSi |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 2-[(4aS,5aR)-5a-methyl-1-(2-trimethylsilylethoxymethyl)-4,4a,5,6-tetrahydrocyclopropa[f]indazol-3-yl]-N-methyl-1H-imidazo[4,5-b]pyridin-6-amine |
| SMILES | CNc1cnc2nc(-c3nn(COCC[Si](C)(C)C)c4c3C[C@@H]3C[C@]3(C)C4)[nH]c2c1 |
| InChI | InChI=1S/C22H32N6OSi/c1-22-10-14(22)8-16-18(11-22)28(13-29-6-7-30(3,4)5)27-19(16)21-25-17-9-15(23-2)12-24-20(17)26-21/h9,12,14,23H,6-8,10-11,13H2,1-5H3,(H,24,25,26)/t14-,22-/m1/s1 |
| InChIKey | WMBXAYLWUUQKSH-JLCFBVMHSA-N |
| XLogP | 4.30 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|