C16H18N2O2 — CID 164532925
methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate (PubChem CID 164532925) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate.
| Compound Name | methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 164532925 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate |
| SMILES | COC(=O)c1ccnc2ccc(N3CC(C)(C)C3)cc12 |
| InChI | InChI=1S/C16H18N2O2/c1-16(2)9-18(10-16)11-4-5-14-13(8-11)12(6-7-17-14)15(19)20-3/h4-8H,9-10H2,1-3H3 |
| InChIKey | JSKDKFIFJGROKD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |