methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate

C16H18N2O2 — CID 164532925

IUPACmethyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate
SMILESCOC(=O)c1ccnc2ccc(N3CC(C)(C)C3)cc12
InChIInChI=1S/C16H18N2O2/c1-16(2)9-18(10-16)11-4-5-14-13(8-11)12(6-7-17-14)15(19)20-3/h4-8H,9-10H2,1-3H3
InChIKeyJSKDKFIFJGROKD-UHFFFAOYSA-N
MW270.33 g/mol
LogP2.87
Rot. Bonds2

About methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate

methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate (PubChem CID 164532925) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate.

Molecular Properties

Compound Namemethyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate
PubChem CID164532925
Molecular FormulaC16H18N2O2
Molecular Weight270.33 g/mol
Exact Mass270.14
IUPAC Namemethyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate
SMILESCOC(=O)c1ccnc2ccc(N3CC(C)(C)C3)cc12
InChIInChI=1S/C16H18N2O2/c1-16(2)9-18(10-16)11-4-5-14-13(8-11)12(6-7-17-14)15(19)20-3/h4-8H,9-10H2,1-3H3
InChIKeyJSKDKFIFJGROKD-UHFFFAOYSA-N
XLogP2.87
TPSA42.43 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.33
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate?
The IUPAC name of methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate (CID 164532925) is methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate.
What is the SMILES notation for methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate?
The canonical SMILES for methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate is COC(=O)c1ccnc2ccc(N3CC(C)(C)C3)cc12.
What is the InChIKey of methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate?
The InChIKey is JSKDKFIFJGROKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-16(2)9-18(10-16)11-4-5-14-13(8-11)12(6-7-17-14)15(19)20-3/h4-8H,9-10H2,1-3H3.
What are the key properties of methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate?
methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate has a molecular weight of 270.33 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3,3-dimethylazetidin-1-yl)quinoline-4-carboxylate is sourced from PubChem (CID 164532925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).