C14H27O4P — CID 164534141
9-hydroxy-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9λ5-phosphaspiro[5.5]undecane 9-oxide (PubChem CID 164534141) has the molecular formula C14H27O4P and a molecular weight of 290.34 g/mol. Its IUPAC name is 9-hydroxy-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9λ5-phosphaspiro[5.5]undecane 9-oxide.
| Compound Name | 9-hydroxy-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9λ5-phosphaspiro[5.5]undecane 9-oxide |
|---|---|
| PubChem CID | 164534141 |
| Molecular Formula | C14H27O4P |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 9-hydroxy-3,3,8,8,10,10-hexamethyl-1,5-dioxa-9λ5-phosphaspiro[5.5]undecane 9-oxide |
| SMILES | CC1(C)COC2(CC(C)(C)P(=O)(O)C(C)(C)C2)OC1 |
| InChI | InChI=1S/C14H27O4P/c1-11(2)9-17-14(18-10-11)7-12(3,4)19(15,16)13(5,6)8-14/h7-10H2,1-6H3,(H,15,16) |
| InChIKey | MLOHQNUKQNZRRY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|