C21H27ClFN5O2 — CID 164534324
1-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 164534324) has the molecular formula C21H27ClFN5O2 and a molecular weight of 435.93 g/mol. Its IUPAC name is 1-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | 1-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 164534324 |
| Molecular Formula | C21H27ClFN5O2 |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 1-[7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | CC1(O)CCCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C21H27ClFN5O2/c1-20(29)5-2-8-27(12-20)18-14-11-24-17(22)15(23)16(14)25-19(26-18)30-13-21-6-3-9-28(21)10-4-7-21/h11,29H,2-10,12-13H2,1H3 |
| InChIKey | XRIUKNYWAOTJNO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|