C31H33F2N7O2 — CID 164534356
[1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]urea (PubChem CID 164534356) has the molecular formula C31H33F2N7O2 and a molecular weight of 573.65 g/mol. Its IUPAC name is [1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]urea.
| Compound Name | [1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]urea |
|---|---|
| PubChem CID | 164534356 |
| Molecular Formula | C31H33F2N7O2 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [1-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]urea |
| SMILES | NC(=O)NC1CCCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(F)c45)ncc23)C1 |
| InChI | InChI=1S/C31H33F2N7O2/c32-23-10-2-7-19-6-1-9-21(24(19)23)26-25(33)27-22(16-35-26)28(39-13-3-8-20(17-39)36-29(34)41)38-30(37-27)42-18-31-11-4-14-40(31)15-5-12-31/h1-2,6-7,9-10,16,20H,3-5,8,11-15,17-18H2,(H3,34,36,41) |
| InChIKey | UNWQDTDDSCAKOL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |