About 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane
1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane (PubChem CID 164534379) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane.
Analyze 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane?
The IUPAC name of 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane (CID 164534379) is 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane.
What is the SMILES notation for 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane?
The canonical SMILES for 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane is C.OCC12CCCN1CCC2.
What is the InChIKey of 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane?
The InChIKey is HPUWIADAVMUUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.CH4/c10-7-8-3-1-5-9(8)6-2-4-8;/h10H,1-7H2;1H4.
What are the key properties of 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane?
1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane has a molecular weight of 157.26 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol;methane is sourced from PubChem (CID 164534379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).