C21H26ClF2N5O2 — CID 164534406
1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 164534406) has the molecular formula C21H26ClF2N5O2 and a molecular weight of 453.92 g/mol. Its IUPAC name is 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 164534406 |
| Molecular Formula | C21H26ClF2N5O2 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | CC1(O)CCCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)ncc23)C1 |
| InChI | InChI=1S/C21H26ClF2N5O2/c1-20(30)4-2-6-28(11-20)18-14-9-25-17(22)15(24)16(14)26-19(27-18)31-12-21-5-3-7-29(21)10-13(23)8-21/h9,13,30H,2-8,10-12H2,1H3/t13-,20?,21+/m1/s1 |
| InChIKey | FBMBAZWBKKRTJZ-JGMTUJDFSA-N |
| XLogP | 3.12 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|