C29H31Cl2FN4O2Si — CID 164534493
tert-butyl-[[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]methoxy]-diphenylsilane (PubChem CID 164534493) has the molecular formula C29H31Cl2FN4O2Si and a molecular weight of 585.58 g/mol. Its IUPAC name is tert-butyl-[[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164534493 |
| Molecular Formula | C29H31Cl2FN4O2Si |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | tert-butyl-[[4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-1,4-oxazepan-6-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCC1COCCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31Cl2FN4O2Si/c1-29(2,3)39(21-10-6-4-7-11-21,22-12-8-5-9-13-22)38-19-20-17-36(14-15-37-18-20)27-23-16-33-26(30)24(32)25(23)34-28(31)35-27/h4-13,16,20H,14-15,17-19H2,1-3H3 |
| InChIKey | LZQQBQKJSXKYEY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|