C25H35NO2Si — CID 164534497
[(3R,8R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 164534497) has the molecular formula C25H35NO2Si and a molecular weight of 409.65 g/mol. Its IUPAC name is [(3R,8R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(3R,8R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 164534497 |
| Molecular Formula | C25H35NO2Si |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | [(3R,8R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1CC[C@@]2(CO)CCCN12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35NO2Si/c1-24(2,3)29(22-11-6-4-7-12-22,23-13-8-5-9-14-23)28-19-21-15-17-25(20-27)16-10-18-26(21)25/h4-9,11-14,21,27H,10,15-20H2,1-3H3/t21-,25-/m1/s1 |
| InChIKey | RFMAKPJNBOXLLL-PXDATVDWSA-N |
| XLogP | 3.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|