7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid

C11H7FO4 — CID 164534500

IUPAC7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid
SMILESO=C(O)c1c(O)cc2ccc(F)cc2c1O
InChIInChI=1S/C11H7FO4/c12-6-2-1-5-3-8(13)9(11(15)16)10(14)7(5)4-6/h1-4,13-14H,(H,15,16)
InChIKeyIXSAGVOEEDYWKU-UHFFFAOYSA-N
MW222.17 g/mol
LogP2.09
Rot. Bonds1

About 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid

7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid (PubChem CID 164534500) has the molecular formula C11H7FO4 and a molecular weight of 222.17 g/mol. Its IUPAC name is 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid.

Molecular Properties

Compound Name7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid
PubChem CID164534500
Molecular FormulaC11H7FO4
Molecular Weight222.17 g/mol
Exact Mass222.03
IUPAC Name7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid
SMILESO=C(O)c1c(O)cc2ccc(F)cc2c1O
InChIInChI=1S/C11H7FO4/c12-6-2-1-5-3-8(13)9(11(15)16)10(14)7(5)4-6/h1-4,13-14H,(H,15,16)
InChIKeyIXSAGVOEEDYWKU-UHFFFAOYSA-N
XLogP2.09
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.17
LogP ≤ 52.09
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-fluoro-10-hydroxyphenanthrene-9-carboxylic acid
CID 174931024
2-chloro-7-fluoronaphthalen-1-ol
CID 175899189
1-chloro-3-hydroxynaphthalene-2-carboxylic acid
CID 57137470
3-hydroxy-1-phenoxynaphthalene-2-carboxylic acid
CID 101339177
7-fluoro-3-(2-methoxy-2-oxoethyl)-2-methylnaphthalene-1-carboxylic acid
CID 59326734
2-(4-chlorophenyl)-6-fluoro-3-hydroxyquinoline-4-carboxylic acid
CID 14498162
2,5-difluoro-1-benzothiophene-3-carboxylic acid
CID 131191531
5-fluoro-2-(4-fluoro-2-hydroxyphenyl)benzoic acid
CID 53225681
4-(4-fluoro-2-hydroxyphenyl)-3-hydroxybenzoic acid
CID 53225677
2,6-difluoronaphthalen-1-ol;prop-2-enoic acid
CID 175546672
6-fluoro-1-methylnaphthalene-2-carboxylic acid
CID 115023270
2,6-dihydroxynaphthalene-1-carboxylic acid
CID 10149075

Frequently Asked Questions

What is the IUPAC name of 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid?
The IUPAC name of 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid (CID 164534500) is 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid.
What is the SMILES notation for 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid?
The canonical SMILES for 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid is O=C(O)c1c(O)cc2ccc(F)cc2c1O.
What is the InChIKey of 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid?
The InChIKey is IXSAGVOEEDYWKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FO4/c12-6-2-1-5-3-8(13)9(11(15)16)10(14)7(5)4-6/h1-4,13-14H,(H,15,16).
What are the key properties of 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid?
7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid has a molecular weight of 222.17 g/mol, XLogP of 2.09, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,3-dihydroxynaphthalene-2-carboxylic acid is sourced from PubChem (CID 164534500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).