C22H28ClF2N5O2 — CID 164534523
1-[[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol (PubChem CID 164534523) has the molecular formula C22H28ClF2N5O2 and a molecular weight of 467.95 g/mol. Its IUPAC name is 1-[[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 164534523 |
| Molecular Formula | C22H28ClF2N5O2 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 1-[[[7-chloro-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol |
| SMILES | OC1(CNc2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(Cl)ncc23)CCCCC1 |
| InChI | InChI=1S/C22H28ClF2N5O2/c23-18-16(25)17-15(10-26-18)19(27-12-22(31)6-2-1-3-7-22)29-20(28-17)32-13-21-5-4-8-30(21)11-14(24)9-21/h10,14,31H,1-9,11-13H2,(H,27,28,29)/t14-,21+/m1/s1 |
| InChIKey | XEOKZGCHZQNMLC-SZNDQCEHSA-N |
| XLogP | 3.88 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|