C32H31F2N7O3 — CID 164534723
9-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 164534723) has the molecular formula C32H31F2N7O3 and a molecular weight of 599.64 g/mol. Its IUPAC name is 9-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 164534723 |
| Molecular Formula | C32H31F2N7O3 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 9-[8-fluoro-7-(8-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(-c5cccc6cccc(F)c56)ncc34)C2)N1 |
| InChI | InChI=1S/C32H31F2N7O3/c33-22-9-2-7-19-6-1-8-20(23(19)22)25-24(34)26-21(16-35-25)27(40-13-5-12-32(17-40)28(42)38-29(43)39-32)37-30(36-26)44-18-31-10-3-14-41(31)15-4-11-31/h1-2,6-9,16H,3-5,10-15,17-18H2,(H2,38,39,42,43) |
| InChIKey | UNYSYBLCWREMGA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|