About 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine
2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine (PubChem CID 164534899) has the molecular formula C12H11Cl2FN4
and a molecular weight of 301.15 g/mol. Its IUPAC name is 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine |
| PubChem CID | 164534899 |
| Molecular Formula | C12H11Cl2FN4 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3CCCCC3)nc(Cl)nc12 |
| InChI | InChI=1S/C12H11Cl2FN4/c13-10-8(15)9-7(6-16-10)11(18-12(14)17-9)19-4-2-1-3-5-19/h6H,1-5H2 |
| InChIKey | HHAMTFDENDEBSM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine?
The IUPAC name of 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine (CID 164534899) is 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine?
The canonical SMILES for 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine is Fc1c(Cl)ncc2c(N3CCCCC3)nc(Cl)nc12.
What is the InChIKey of 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine?
The InChIKey is HHAMTFDENDEBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2FN4/c13-10-8(15)9-7(6-16-10)11(18-12(14)17-9)19-4-2-1-3-5-19/h6H,1-5H2.
What are the key properties of 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine?
2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine has a molecular weight of 301.15 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dichloro-8-fluoro-4-piperidin-1-ylpyrido[4,3-d]pyrimidine is sourced from PubChem (CID 164534899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).