C18H26BFO2 — CID 164534919
2-[(Z,1Z)-1-(4-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164534919) has the molecular formula C18H26BFO2 and a molecular weight of 304.21 g/mol. Its IUPAC name is 2-[(Z,1Z)-1-(4-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z,1Z)-1-(4-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164534919 |
| Molecular Formula | C18H26BFO2 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 2-[(Z,1Z)-1-(4-fluoro-5,6-dimethylcyclohexa-2,4-dien-1-ylidene)but-2-en-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C=C(\C=C1\C=CC(F)=C(C)C1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BFO2/c1-8-15(19-21-17(4,5)18(6,7)22-19)11-14-9-10-16(20)13(3)12(14)2/h8-12H,1-7H3/b14-11-,15-8+ |
| InChIKey | LWVJWORLZJOSDV-WFVWYMPTSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|