About (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate
(7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate (PubChem CID 164534939) has the molecular formula C16H17FO3
and a molecular weight of 276.31 g/mol. Its IUPAC name is (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate |
| PubChem CID | 164534939 |
| Molecular Formula | C16H17FO3 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate |
| SMILES | Cc1c(F)ccc2cc(O)cc(OC(=O)C(C)(C)C)c12 |
| InChI | InChI=1S/C16H17FO3/c1-9-12(17)6-5-10-7-11(18)8-13(14(9)10)20-15(19)16(2,3)4/h5-8,18H,1-4H3 |
| InChIKey | JETBZPHOHAHREY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate?
The IUPAC name of (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate (CID 164534939) is (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate is Cc1c(F)ccc2cc(O)cc(OC(=O)C(C)(C)C)c12.
What is the InChIKey of (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate?
The InChIKey is JETBZPHOHAHREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FO3/c1-9-12(17)6-5-10-7-11(18)8-13(14(9)10)20-15(19)16(2,3)4/h5-8,18H,1-4H3.
What are the key properties of (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate?
(7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate has a molecular weight of 276.31 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-3-hydroxy-8-methylnaphthalen-1-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 164534939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).