C34H45F2N7OS — CID 164535021
N-[3-(aminomethyl)-1-[7-[(E)-1-(2-butyl-6-fluorophenyl)prop-1-enyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]thiohydroxylamine (PubChem CID 164535021) has the molecular formula C34H45F2N7OS and a molecular weight of 637.85 g/mol. Its IUPAC name is N-[3-(aminomethyl)-1-[7-[(E)-1-(2-butyl-6-fluorophenyl)prop-1-enyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]thiohydroxylamine.
| Compound Name | N-[3-(aminomethyl)-1-[7-[(E)-1-(2-butyl-6-fluorophenyl)prop-1-enyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 164535021 |
| Molecular Formula | C34H45F2N7OS |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | N-[3-(aminomethyl)-1-[7-[(E)-1-(2-butyl-6-fluorophenyl)prop-1-enyl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-4-yl]piperidin-3-yl]thiohydroxylamine |
| SMILES | C/C=C(/c1ncc2c(N3CCCC(CN)(NS)C3)nc(OCC34CCCN3CCC4)nc2c1F)c1c(F)cccc1CCCC |
| InChI | InChI=1S/C34H45F2N7OS/c1-3-5-10-23-11-6-12-26(35)27(23)24(4-2)29-28(36)30-25(19-38-29)31(42-16-7-13-33(20-37,21-42)41-45)40-32(39-30)44-22-34-14-8-17-43(34)18-9-15-34/h4,6,11-12,19,41,45H,3,5,7-10,13-18,20-22,37H2,1-2H3/b24-4+ |
| InChIKey | HDCYBZRSNDPPKM-FZZGJVLGSA-N |
| XLogP | 5.84 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|