C24H33NO2Si — CID 164535102
[(2S,8R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 164535102) has the molecular formula C24H33NO2Si and a molecular weight of 395.62 g/mol. Its IUPAC name is [(2S,8R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(2S,8R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 164535102 |
| Molecular Formula | C24H33NO2Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [(2S,8R)-2-[tert-butyl(diphenyl)silyl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | CC(C)(C)[Si](O[C@@H]1CN2CCC[C@]2(CO)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33NO2Si/c1-23(2,3)28(21-11-6-4-7-12-21,22-13-8-5-9-14-22)27-20-17-24(19-26)15-10-16-25(24)18-20/h4-9,11-14,20,26H,10,15-19H2,1-3H3/t20-,24+/m0/s1 |
| InChIKey | WMKMGSUKLZTBPU-GBXCKJPGSA-N |
| XLogP | 3.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|