C13H13Cl2FN4O — CID 164535125
(3R,6R)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methylpiperidin-3-ol (PubChem CID 164535125) has the molecular formula C13H13Cl2FN4O and a molecular weight of 331.18 g/mol. Its IUPAC name is (3R,6R)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methylpiperidin-3-ol.
| Compound Name | (3R,6R)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 164535125 |
| Molecular Formula | C13H13Cl2FN4O |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (3R,6R)-1-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-6-methylpiperidin-3-ol |
| SMILES | C[C@@H]1CC[C@@H](O)CN1c1nc(Cl)nc2c(F)c(Cl)ncc12 |
| InChI | InChI=1S/C13H13Cl2FN4O/c1-6-2-3-7(21)5-20(6)12-8-4-17-11(14)9(16)10(8)18-13(15)19-12/h4,6-7,21H,2-3,5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | QJONQFPMLRPQCP-RNFRBKRXSA-N |
| XLogP | 2.82 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|