C24H31BN2O3 — CID 164535354
5-ethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[f]indazole (PubChem CID 164535354) has the molecular formula C24H31BN2O3 and a molecular weight of 406.34 g/mol. Its IUPAC name is 5-ethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[f]indazole.
| Compound Name | 5-ethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[f]indazole |
|---|---|
| PubChem CID | 164535354 |
| Molecular Formula | C24H31BN2O3 |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 5-ethyl-1-(oxan-2-yl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[f]indazole |
| SMILES | CCc1cccc2cc3c(cnn3C3CCCCO3)c(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C24H31BN2O3/c1-6-16-10-9-11-17-14-19-18(15-26-27(19)20-12-7-8-13-28-20)22(21(16)17)25-29-23(2,3)24(4,5)30-25/h9-11,14-15,20H,6-8,12-13H2,1-5H3 |
| InChIKey | AUMYMONRRNMKQN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|