About (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide
(S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 164536336) has the molecular formula C10H21F2NOS
and a molecular weight of 241.35 g/mol. Its IUPAC name is (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 164536336 |
| Molecular Formula | C10H21F2NOS |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@H](CCC(F)F)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C10H21F2NOS/c1-5-8(6-7-9(11)12)13-15(14)10(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,15+/m1/s1 |
| InChIKey | RPVSFTNXZCFLDX-GLEZIHRCSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide (CID 164536336) is (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide is CC[C@H](CCC(F)F)N[S@@](=O)C(C)(C)C.
What is the InChIKey of (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is RPVSFTNXZCFLDX-GLEZIHRCSA-N. The full InChI is InChI=1S/C10H21F2NOS/c1-5-8(6-7-9(11)12)13-15(14)10(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,15+/m1/s1.
What are the key properties of (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide?
(S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 241.35 g/mol, XLogP of 2.86, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-[(3R)-6,6-difluorohexan-3-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 164536336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).