C23H23F9N6O3 — CID 164536352
1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-b]pyridazin-6-yl)-2-pyridinyl]ethyl]urea (PubChem CID 164536352) has the molecular formula C23H23F9N6O3 and a molecular weight of 602.46 g/mol. Its IUPAC name is 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-b]pyridazin-6-yl)-2-pyridinyl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-b]pyridazin-6-yl)-2-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 164536352 |
| Molecular Formula | C23H23F9N6O3 |
| Molecular Weight | 602.46 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[2,2,2-trifluoro-1-[5-methoxy-4-(8-methoxyimidazo[1,2-b]pyridazin-6-yl)-2-pyridinyl]ethyl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)C(c1cc(-c2cc(OC)c3nccn3n2)c(OC)cn1)C(F)(F)F |
| InChI | InChI=1S/C23H23F9N6O3/c1-4-37(20(39)35-17(22(27,28)29)5-6-21(24,25)26)18(23(30,31)32)14-9-12(16(41-3)11-34-14)13-10-15(40-2)19-33-7-8-38(19)36-13/h7-11,17-18H,4-6H2,1-3H3,(H,35,39)/t17-,18?/m0/s1 |
| InChIKey | OIDIFRVDOSYDEZ-ZENAZSQFSA-N |
| XLogP | 5.72 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |