C24H25ClF6N4O2 — CID 164536360
1-[(1R)-1-[3-(3-chloro-8-methoxyimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea (PubChem CID 164536360) has the molecular formula C24H25ClF6N4O2 and a molecular weight of 550.93 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(3-chloro-8-methoxyimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea.
| Compound Name | 1-[(1R)-1-[3-(3-chloro-8-methoxyimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
|---|---|
| PubChem CID | 164536360 |
| Molecular Formula | C24H25ClF6N4O2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 1-[(1R)-1-[3-(3-chloro-8-methoxyimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)[C@H](C)c1cccc(-c2cc(OC)c3ncc(Cl)n3c2)c1 |
| InChI | InChI=1S/C24H25ClF6N4O2/c1-4-34(22(36)33-19(24(29,30)31)8-9-23(26,27)28)14(2)15-6-5-7-16(10-15)17-11-18(37-3)21-32-12-20(25)35(21)13-17/h5-7,10-14,19H,4,8-9H2,1-3H3,(H,33,36)/t14-,19+/m1/s1 |
| InChIKey | UCRYSHHYUHKRSO-KUHUBIRLSA-N |
| XLogP | 7.03 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |