C22H21ClF7N5O — CID 164536430
1-[1-[5-chloro-4-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-2-pyridinyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea (PubChem CID 164536430) has the molecular formula C22H21ClF7N5O and a molecular weight of 539.88 g/mol. Its IUPAC name is 1-[1-[5-chloro-4-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-2-pyridinyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea.
| Compound Name | 1-[1-[5-chloro-4-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-2-pyridinyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
|---|---|
| PubChem CID | 164536430 |
| Molecular Formula | C22H21ClF7N5O |
| Molecular Weight | 539.88 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-[1-[5-chloro-4-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-2-pyridinyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)C(C)c1cc(-c2cc(F)c3nccn3c2)c(Cl)cn1 |
| InChI | InChI=1S/C22H21ClF7N5O/c1-3-35(20(36)33-18(22(28,29)30)4-5-21(25,26)27)12(2)17-9-14(15(23)10-32-17)13-8-16(24)19-31-6-7-34(19)11-13/h6-12,18H,3-5H2,1-2H3,(H,33,36)/t12?,18-/m0/s1 |
| InChIKey | CNWMTWJJCGJYSJ-ZJFPTPTDSA-N |
| XLogP | 6.55 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |