C23H25F6N5O — CID 164536441
1-[(1R)-1-[3-(3-aminoimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea (PubChem CID 164536441) has the molecular formula C23H25F6N5O and a molecular weight of 501.48 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(3-aminoimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea.
| Compound Name | 1-[(1R)-1-[3-(3-aminoimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
|---|---|
| PubChem CID | 164536441 |
| Molecular Formula | C23H25F6N5O |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 1-[(1R)-1-[3-(3-aminoimidazo[1,2-a]pyridin-6-yl)phenyl]ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)[C@H](C)c1cccc(-c2ccc3ncc(N)n3c2)c1 |
| InChI | InChI=1S/C23H25F6N5O/c1-3-33(21(35)32-18(23(27,28)29)9-10-22(24,25)26)14(2)15-5-4-6-16(11-15)17-7-8-20-31-12-19(30)34(20)13-17/h4-8,11-14,18H,3,9-10,30H2,1-2H3,(H,32,35)/t14-,18+/m1/s1 |
| InChIKey | JPHJBIUEAZGIJK-KDOFPFPSSA-N |
| XLogP | 5.95 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |