About (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine
(1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine (PubChem CID 164536563) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine |
| PubChem CID | 164536563 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine |
| SMILES | CC[C@@H](N)C1CC(F)(F)CCO1 |
| InChI | InChI=1S/C8H15F2NO/c1-2-6(11)7-5-8(9,10)3-4-12-7/h6-7H,2-5,11H2,1H3/t6-,7?/m1/s1 |
| InChIKey | SKNFKLQCPUZHJW-ULUSZKPHSA-N |
| XLogP | 1.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine?
The IUPAC name of (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine (CID 164536563) is (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine.
What is the SMILES notation for (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine?
The canonical SMILES for (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine is CC[C@@H](N)C1CC(F)(F)CCO1.
What is the InChIKey of (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine?
The InChIKey is SKNFKLQCPUZHJW-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-2-6(11)7-5-8(9,10)3-4-12-7/h6-7H,2-5,11H2,1H3/t6-,7?/m1/s1.
What are the key properties of (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine?
(1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine has a molecular weight of 179.21 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(4,4-difluorooxan-2-yl)propan-1-amine is sourced from PubChem (CID 164536563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).