C26H30F5N5O2 — CID 164536581
3-[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]-1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea (PubChem CID 164536581) has the molecular formula C26H30F5N5O2 and a molecular weight of 539.55 g/mol. Its IUPAC name is 3-[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]-1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea.
| Compound Name | 3-[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]-1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 164536581 |
| Molecular Formula | C26H30F5N5O2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 3-[(1S)-1-(3,3-difluorocyclohexyl)-2,2,2-trifluoroethyl]-1-ethyl-1-[(1R)-1-[3-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)phenyl]ethyl]urea |
| SMILES | CCN(C(=O)N[C@@H](C1CCCC(F)(F)C1)C(F)(F)F)[C@H](C)c1cccc(-c2cn3ccnc3c(OC)n2)c1 |
| InChI | InChI=1S/C26H30F5N5O2/c1-4-36(24(37)34-21(26(29,30)31)19-9-6-10-25(27,28)14-19)16(2)17-7-5-8-18(13-17)20-15-35-12-11-32-22(35)23(33-20)38-3/h5,7-8,11-13,15-16,19,21H,4,6,9-10,14H2,1-3H3,(H,34,37)/t16-,19?,21+/m1/s1 |
| InChIKey | ASMFYWPVOKVIDT-SZBOGAFOSA-N |
| XLogP | 6.25 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |