C16H20BrF6N3O2 — CID 164536601
1-[(1R)-1-(5-bromo-1-methyl-6-oxo-3-pyridinyl)ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea (PubChem CID 164536601) has the molecular formula C16H20BrF6N3O2 and a molecular weight of 480.25 g/mol. Its IUPAC name is 1-[(1R)-1-(5-bromo-1-methyl-6-oxo-3-pyridinyl)ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea.
| Compound Name | 1-[(1R)-1-(5-bromo-1-methyl-6-oxo-3-pyridinyl)ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
|---|---|
| PubChem CID | 164536601 |
| Molecular Formula | C16H20BrF6N3O2 |
| Molecular Weight | 480.25 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | 1-[(1R)-1-(5-bromo-1-methyl-6-oxo-3-pyridinyl)ethyl]-1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)[C@H](C)c1cc(Br)c(=O)n(C)c1 |
| InChI | InChI=1S/C16H20BrF6N3O2/c1-4-26(9(2)10-7-11(17)13(27)25(3)8-10)14(28)24-12(16(21,22)23)5-6-15(18,19)20/h7-9,12H,4-6H2,1-3H3,(H,24,28)/t9-,12+/m1/s1 |
| InChIKey | FVSLJRAXMLMIAE-SKDRFNHKSA-N |
| XLogP | 4.51 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |