C25H26F9N5O3 — CID 164536639
1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1S)-2,2,2-trifluoro-1-[5-methoxy-4-(7-methoxy-3-methylbenzimidazol-5-yl)-2-pyridinyl]ethyl]urea (PubChem CID 164536639) has the molecular formula C25H26F9N5O3 and a molecular weight of 615.50 g/mol. Its IUPAC name is 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1S)-2,2,2-trifluoro-1-[5-methoxy-4-(7-methoxy-3-methylbenzimidazol-5-yl)-2-pyridinyl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1S)-2,2,2-trifluoro-1-[5-methoxy-4-(7-methoxy-3-methylbenzimidazol-5-yl)-2-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 164536639 |
| Molecular Formula | C25H26F9N5O3 |
| Molecular Weight | 615.50 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1S)-2,2,2-trifluoro-1-[5-methoxy-4-(7-methoxy-3-methylbenzimidazol-5-yl)-2-pyridinyl]ethyl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)[C@@H](c1cc(-c2cc(OC)c3ncn(C)c3c2)c(OC)cn1)C(F)(F)F |
| InChI | InChI=1S/C25H26F9N5O3/c1-5-39(22(40)37-19(24(29,30)31)6-7-23(26,27)28)21(25(32,33)34)15-10-14(18(42-4)11-35-15)13-8-16-20(17(9-13)41-3)36-12-38(16)2/h8-12,19,21H,5-7H2,1-4H3,(H,37,40)/t19-,21-/m0/s1 |
| InChIKey | VLXVMMFUHZFPQE-FPOVZHCZSA-N |
| XLogP | 6.56 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |