C23H26F6N6O3 — CID 164536645
1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1R)-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea (PubChem CID 164536645) has the molecular formula C23H26F6N6O3 and a molecular weight of 548.49 g/mol. Its IUPAC name is 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1R)-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1R)-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea |
|---|---|
| PubChem CID | 164536645 |
| Molecular Formula | C23H26F6N6O3 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 1-ethyl-3-[(2S)-1,1,1,5,5,5-hexafluoropentan-2-yl]-1-[(1R)-1-[5-methoxy-4-(8-methoxyimidazo[1,2-a]pyrazin-6-yl)-2-pyridinyl]ethyl]urea |
| SMILES | CCN(C(=O)N[C@@H](CCC(F)(F)F)C(F)(F)F)[C@H](C)c1cc(-c2cn3ccnc3c(OC)n2)c(OC)cn1 |
| InChI | InChI=1S/C23H26F6N6O3/c1-5-35(21(36)33-18(23(27,28)29)6-7-22(24,25)26)13(2)15-10-14(17(37-3)11-31-15)16-12-34-9-8-30-19(34)20(32-16)38-4/h8-13,18H,5-7H2,1-4H3,(H,33,36)/t13-,18+/m1/s1 |
| InChIKey | ITBXEGSPKUHVQU-ACJLOTCBSA-N |
| XLogP | 5.17 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |