C31H30F2N6O7S — CID 164537419
ethyl (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate (PubChem CID 164537419) has the molecular formula C31H30F2N6O7S and a molecular weight of 668.68 g/mol. Its IUPAC name is ethyl (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164537419 |
| Molecular Formula | C31H30F2N6O7S |
| Molecular Weight | 668.68 g/mol |
| Exact Mass | 668.19 |
| IUPAC Name | ethyl (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1-c1ccc(Oc3ccc(F)cc3F)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C31H30F2N6O7S/c1-2-45-31(40)30-29-28(35-38(30)21-8-10-22(11-9-21)46-26-12-7-20(32)19-23(26)33)25(13-14-34-29)36-15-17-37(18-16-36)47(43,44)27-6-4-3-5-24(27)39(41)42/h3-12,19,25,34H,2,13-18H2,1H3/t25-/m1/s1 |
| InChIKey | NNHKFTKRWDLLBS-RUZDIDTESA-N |
| XLogP | 4.89 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.68 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|