C29H27F2N7O6S — CID 164537529
(7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide (PubChem CID 164537529) has the molecular formula C29H27F2N7O6S and a molecular weight of 639.64 g/mol. Its IUPAC name is (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide.
| Compound Name | (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164537529 |
| Molecular Formula | C29H27F2N7O6S |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | (7R)-2-[4-(2,4-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c2c(nn1-c1ccc(Oc3ccc(F)cc3F)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C29H27F2N7O6S/c30-18-5-10-24(21(31)17-18)44-20-8-6-19(7-9-20)37-28(29(32)39)27-26(34-37)23(11-12-33-27)35-13-15-36(16-14-35)45(42,43)25-4-2-1-3-22(25)38(40)41/h1-10,17,23,33H,11-16H2,(H2,32,39)/t23-/m1/s1 |
| InChIKey | LWJIONRAJPZCKP-HSZRJFAPSA-N |
| XLogP | 3.81 |
| TPSA | 165.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|