C32H31F3N6O8S — CID 164537545
ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate (PubChem CID 164537545) has the molecular formula C32H31F3N6O8S and a molecular weight of 716.70 g/mol. Its IUPAC name is ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164537545 |
| Molecular Formula | C32H31F3N6O8S |
| Molecular Weight | 716.70 g/mol |
| Exact Mass | 716.19 |
| IUPAC Name | ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethoxy)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1-c1ccc(Oc3cccc(OC(F)(F)F)c3)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C32H31F3N6O8S/c1-2-47-31(42)30-29-28(37-40(30)21-10-12-22(13-11-21)48-23-6-5-7-24(20-23)49-32(33,34)35)26(14-15-36-29)38-16-18-39(19-17-38)50(45,46)27-9-4-3-8-25(27)41(43)44/h3-13,20,26,36H,2,14-19H2,1H3/t26-/m1/s1 |
| InChIKey | LPNNUMKQIUHREN-AREMUKBSSA-N |
| XLogP | 5.51 |
| TPSA | 158.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|