C30H27F3N6O7S — CID 164537632
(7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid (PubChem CID 164537632) has the molecular formula C30H27F3N6O7S and a molecular weight of 672.64 g/mol. Its IUPAC name is (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid.
| Compound Name | (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164537632 |
| Molecular Formula | C30H27F3N6O7S |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 672.16 |
| IUPAC Name | (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c2c(nn1-c1ccc(Oc3cccc(C(F)(F)F)c3)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C30H27F3N6O7S/c31-30(32,33)19-4-3-5-22(18-19)46-21-10-8-20(9-11-21)38-28(29(40)41)27-26(35-38)24(12-13-34-27)36-14-16-37(17-15-36)47(44,45)25-7-2-1-6-23(25)39(42)43/h1-11,18,24,34H,12-17H2,(H,40,41)/t24-/m1/s1 |
| InChIKey | NBHGNNMNMGSYAY-XMMPIXPASA-N |
| XLogP | 5.15 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|