C29H26F2N6O7S — CID 164537761
(7R)-2-[4-(2,5-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid (PubChem CID 164537761) has the molecular formula C29H26F2N6O7S and a molecular weight of 640.63 g/mol. Its IUPAC name is (7R)-2-[4-(2,5-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid.
| Compound Name | (7R)-2-[4-(2,5-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 164537761 |
| Molecular Formula | C29H26F2N6O7S |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | (7R)-2-[4-(2,5-difluorophenoxy)phenyl]-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c2c(nn1-c1ccc(Oc3cc(F)ccc3F)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C29H26F2N6O7S/c30-18-5-10-21(31)24(17-18)44-20-8-6-19(7-9-20)36-28(29(38)39)27-26(33-36)23(11-12-32-27)34-13-15-35(16-14-34)45(42,43)25-4-2-1-3-22(25)37(40)41/h1-10,17,23,32H,11-16H2,(H,38,39)/t23-/m1/s1 |
| InChIKey | YEHHCRMMLIHULZ-HSZRJFAPSA-N |
| XLogP | 4.41 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|