About N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane
N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane (PubChem CID 164537867) has the molecular formula C17H31F2NO
and a molecular weight of 303.44 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane |
| PubChem CID | 164537867 |
| Molecular Formula | C17H31F2NO |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane |
| SMILES | CC1CCCC(C(=O)NC2CCC(F)(F)CC2)C1.CCC |
| InChI | InChI=1S/C14H23F2NO.C3H8/c1-10-3-2-4-11(9-10)13(18)17-12-5-7-14(15,16)8-6-12;1-3-2/h10-12H,2-9H2,1H3,(H,17,18);3H2,1-2H3 |
| InChIKey | DBRKHVDILWQDFL-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane?
The IUPAC name of N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane (CID 164537867) is N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane is CC1CCCC(C(=O)NC2CCC(F)(F)CC2)C1.CCC.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane?
The InChIKey is DBRKHVDILWQDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F2NO.C3H8/c1-10-3-2-4-11(9-10)13(18)17-12-5-7-14(15,16)8-6-12;1-3-2/h10-12H,2-9H2,1H3,(H,17,18);3H2,1-2H3.
What are the key properties of N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane?
N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane has a molecular weight of 303.44 g/mol, XLogP of 4.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-3-methylcyclohexane-1-carboxamide;propane is sourced from PubChem (CID 164537867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).