About (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane
(6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane (PubChem CID 164538241) has the molecular formula C13H16N4O3S2
and a molecular weight of 340.43 g/mol. Its IUPAC name is (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane.
Molecular Properties
| Compound Name | (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane |
| PubChem CID | 164538241 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane |
| SMILES | CC.CC(C)c1csc(S(=O)(=O)Oc2ccc(C#N)nn2)n1 |
| InChI | InChI=1S/C11H10N4O3S2.C2H6/c1-7(2)9-6-19-11(13-9)20(16,17)18-10-4-3-8(5-12)14-15-10;1-2/h3-4,6-7H,1-2H3;1-2H3 |
| InChIKey | XHXDQMJLKLOCHR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane?
The IUPAC name of (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane (CID 164538241) is (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane.
What is the SMILES notation for (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane?
The canonical SMILES for (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane is CC.CC(C)c1csc(S(=O)(=O)Oc2ccc(C#N)nn2)n1.
What is the InChIKey of (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane?
The InChIKey is XHXDQMJLKLOCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O3S2.C2H6/c1-7(2)9-6-19-11(13-9)20(16,17)18-10-4-3-8(5-12)14-15-10;1-2/h3-4,6-7H,1-2H3;1-2H3.
What are the key properties of (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane?
(6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane has a molecular weight of 340.43 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyanopyridazin-3-yl) 4-propan-2-yl-1,3-thiazole-2-sulfonate;ethane is sourced from PubChem (CID 164538241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).