C14H26BrN3O3 — CID 164538661
tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate;ethane (PubChem CID 164538661) has the molecular formula C14H26BrN3O3 and a molecular weight of 364.28 g/mol. Its IUPAC name is tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate;ethane.
| Compound Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate;ethane |
|---|---|
| PubChem CID | 164538661 |
| Molecular Formula | C14H26BrN3O3 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate;ethane |
| SMILES | CC.Cn1ncc(Br)c1CN(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20BrN3O3.C2H6/c1-12(2,3)19-11(18)16(5-6-17)8-10-9(13)7-14-15(10)4;1-2/h7,17H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | ZMJOQRWGEYZVQY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |