C12H20BrN3O3 — CID 164538662
tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 164538662) has the molecular formula C12H20BrN3O3 and a molecular weight of 334.21 g/mol. Its IUPAC name is tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 164538662 |
| Molecular Formula | C12H20BrN3O3 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | tert-butyl N-[(4-bromo-1-methylpyrazol-5-yl)methyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | Cn1ncc(Br)c1CN(CCO)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20BrN3O3/c1-12(2,3)19-11(18)16(5-6-17)8-10-9(13)7-14-15(10)4/h7,17H,5-6,8H2,1-4H3 |
| InChIKey | ARIUJDPWFUVASS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |