C31H40FN7OS — CID 164539061
ethane;(3R)-1-[3-[1-[2-fluoro-4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylethyl]phenyl]piperidin-3-amine (PubChem CID 164539061) has the molecular formula C31H40FN7OS and a molecular weight of 577.77 g/mol. Its IUPAC name is ethane;(3R)-1-[3-[1-[2-fluoro-4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylethyl]phenyl]piperidin-3-amine.
| Compound Name | ethane;(3R)-1-[3-[1-[2-fluoro-4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylethyl]phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 164539061 |
| Molecular Formula | C31H40FN7OS |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | ethane;(3R)-1-[3-[1-[2-fluoro-4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)anilino]sulfanylethyl]phenyl]piperidin-3-amine |
| SMILES | CC.CC(SNc1ccc(-c2cc3c(N4CCOCC4)ncnc3[nH]2)cc1F)c1cccc(N2CCC[C@@H](N)C2)c1 |
| InChI | InChI=1S/C29H34FN7OS.C2H6/c1-19(20-4-2-6-23(14-20)37-9-3-5-22(31)17-37)39-35-26-8-7-21(15-25(26)30)27-16-24-28(34-27)32-18-33-29(24)36-10-12-38-13-11-36;1-2/h2,4,6-8,14-16,18-19,22,35H,3,5,9-13,17,31H2,1H3,(H,32,33,34);1-2H3/t19?,22-;/m1./s1 |
| InChIKey | ZEFIKHSYDJZLIB-YBRRAQHRSA-N |
| XLogP | 6.38 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|